C27H46O4Si — CID 10863531
(1S,3R,5S,8R,11R)-14-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-8,15,15-trimethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-13-en-9-one (PubChem CID 10863531) has the molecular formula C27H46O4Si and a molecular weight of 462.75 g/mol. Its IUPAC name is (1S,3R,5S,8R,11R)-14-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-8,15,15-trimethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-13-en-9-one.
| Compound Name | (1S,3R,5S,8R,11R)-14-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-8,15,15-trimethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-13-en-9-one |
|---|---|
| PubChem CID | 10863531 |
| Molecular Formula | C27H46O4Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | (1S,3R,5S,8R,11R)-14-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-8,15,15-trimethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-13-en-9-one |
| SMILES | C=C1[C@@H](OCOC)CC[C@@]2(C)C(=O)C[C@H]3CC=C(O[Si](C)(C)C(C)(C)C)[C@@H](C[C@H]12)C3(C)C |
| InChI | InChI=1S/C27H46O4Si/c1-18-20-16-21-23(31-32(9,10)25(2,3)4)12-11-19(26(21,5)6)15-24(28)27(20,7)14-13-22(18)30-17-29-8/h12,19-22H,1,11,13-17H2,2-10H3/t19-,20-,21-,22+,27-/m1/s1 |
| InChIKey | OWCXUTNBOSESAZ-MCAIBZCSSA-N |
| XLogP | 6.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|