C15H21FN2O3 — CID 115577455
[1-oxo-1-(pentan-2-ylamino)propan-2-yl] 2-amino-4-fluorobenzoate (PubChem CID 115577455) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is [1-oxo-1-(pentan-2-ylamino)propan-2-yl] 2-amino-4-fluorobenzoate.
| Compound Name | [1-oxo-1-(pentan-2-ylamino)propan-2-yl] 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 115577455 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [1-oxo-1-(pentan-2-ylamino)propan-2-yl] 2-amino-4-fluorobenzoate |
| SMILES | CCCC(C)NC(=O)C(C)OC(=O)c1ccc(F)cc1N |
| InChI | InChI=1S/C15H21FN2O3/c1-4-5-9(2)18-14(19)10(3)21-15(20)12-7-6-11(16)8-13(12)17/h6-10H,4-5,17H2,1-3H3,(H,18,19) |
| InChIKey | QHFBKBJKGHKBJD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|