C11H18N4OS — CID 115587874
1-(3-methoxypropyl)-3-[(2-methylpyrimidin-4-yl)methyl]thiourea (PubChem CID 115587874) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-[(2-methylpyrimidin-4-yl)methyl]thiourea.
| Compound Name | 1-(3-methoxypropyl)-3-[(2-methylpyrimidin-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 115587874 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-(3-methoxypropyl)-3-[(2-methylpyrimidin-4-yl)methyl]thiourea |
| SMILES | COCCCNC(=S)NCc1ccnc(C)n1 |
| InChI | InChI=1S/C11H18N4OS/c1-9-12-6-4-10(15-9)8-14-11(17)13-5-3-7-16-2/h4,6H,3,5,7-8H2,1-2H3,(H2,13,14,17) |
| InChIKey | GLNIZIVEXFUGIY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|