C18H36O4Si — CID 11559260
(2S)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]butan-1-ol (PubChem CID 11559260) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is (2S)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]butan-1-ol.
| Compound Name | (2S)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]butan-1-ol |
|---|---|
| PubChem CID | 11559260 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (2S)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]butan-1-ol |
| SMILES | C=C[C@H]1OC(C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(CC)CO |
| InChI | InChI=1S/C18H36O4Si/c1-10-13(12-19)15(22-23(8,9)17(3,4)5)16-14(11-2)20-18(6,7)21-16/h11,13-16,19H,2,10,12H2,1,3-9H3/t13?,14-,15+,16+/m1/s1 |
| InChIKey | RDVNQRPJGJXZMB-BSLWCIKASA-N |
| XLogP | 4.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|