About N-[2-(3,5-dichlorophenyl)ethyl]-2,2-dimethylpropan-1-amine;hydrochloride
N-[2-(3,5-dichlorophenyl)ethyl]-2,2-dimethylpropan-1-amine;hydrochloride (PubChem CID 115607511) has the molecular formula C13H20Cl3N
and a molecular weight of 296.67 g/mol. Its IUPAC name is N-[2-(3,5-dichlorophenyl)ethyl]-2,2-dimethylpropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | N-[2-(3,5-dichlorophenyl)ethyl]-2,2-dimethylpropan-1-amine;hydrochloride |
| PubChem CID | 115607511 |
| Molecular Formula | C13H20Cl3N |
| Molecular Weight | 296.67 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | N-[2-(3,5-dichlorophenyl)ethyl]-2,2-dimethylpropan-1-amine;hydrochloride |
| SMILES | CC(C)(C)CNCCc1cc(Cl)cc(Cl)c1.Cl |
| InChI | InChI=1S/C13H19Cl2N.ClH/c1-13(2,3)9-16-5-4-10-6-11(14)8-12(15)7-10;/h6-8,16H,4-5,9H2,1-3H3;1H |
| InChIKey | MMLOPXQDJUWUIU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.67 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,5-dichlorophenyl)ethyl]-2,2-dimethylpropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,5-dichlorophenyl)ethyl]-2,2-dimethylpropan-1-amine;hydrochloride?
The IUPAC name of N-[2-(3,5-dichlorophenyl)ethyl]-2,2-dimethylpropan-1-amine;hydrochloride (CID 115607511) is N-[2-(3,5-dichlorophenyl)ethyl]-2,2-dimethylpropan-1-amine;hydrochloride.
What is the SMILES notation for N-[2-(3,5-dichlorophenyl)ethyl]-2,2-dimethylpropan-1-amine;hydrochloride?
The canonical SMILES for N-[2-(3,5-dichlorophenyl)ethyl]-2,2-dimethylpropan-1-amine;hydrochloride is CC(C)(C)CNCCc1cc(Cl)cc(Cl)c1.Cl.
What is the InChIKey of N-[2-(3,5-dichlorophenyl)ethyl]-2,2-dimethylpropan-1-amine;hydrochloride?
The InChIKey is MMLOPXQDJUWUIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19Cl2N.ClH/c1-13(2,3)9-16-5-4-10-6-11(14)8-12(15)7-10;/h6-8,16H,4-5,9H2,1-3H3;1H.
What are the key properties of N-[2-(3,5-dichlorophenyl)ethyl]-2,2-dimethylpropan-1-amine;hydrochloride?
N-[2-(3,5-dichlorophenyl)ethyl]-2,2-dimethylpropan-1-amine;hydrochloride has a molecular weight of 296.67 g/mol, XLogP of 4.59, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,5-dichlorophenyl)ethyl]-2,2-dimethylpropan-1-amine;hydrochloride is sourced from PubChem (CID 115607511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).