C22H26N2O2S — CID 11560775
1-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-5-(benzenesulfonyl)-2,3-dihydroindole (PubChem CID 11560775) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-5-(benzenesulfonyl)-2,3-dihydroindole.
| Compound Name | 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-5-(benzenesulfonyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 11560775 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-5-(benzenesulfonyl)-2,3-dihydroindole |
| SMILES | O=S(=O)(c1ccccc1)c1ccc2c(c1)CCN2C1CCN2CCCC2C1 |
| InChI | InChI=1S/C22H26N2O2S/c25-27(26,20-6-2-1-3-7-20)21-8-9-22-17(15-21)10-14-24(22)19-11-13-23-12-4-5-18(23)16-19/h1-3,6-9,15,18-19H,4-5,10-14,16H2 |
| InChIKey | LKMOSEGFHKBDOH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |