C7H8Cl3F3N2O6S2 — CID 11561326
2,2,2-trichloroethyl 3-methylimidazol-3-ium-1-sulfonate;trifluoromethanesulfonate (PubChem CID 11561326) has the molecular formula C7H8Cl3F3N2O6S2 and a molecular weight of 443.64 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 3-methylimidazol-3-ium-1-sulfonate;trifluoromethanesulfonate.
| Compound Name | 2,2,2-trichloroethyl 3-methylimidazol-3-ium-1-sulfonate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11561326 |
| Molecular Formula | C7H8Cl3F3N2O6S2 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 441.88 |
| IUPAC Name | 2,2,2-trichloroethyl 3-methylimidazol-3-ium-1-sulfonate;trifluoromethanesulfonate |
| SMILES | C[n+]1ccn(S(=O)(=O)OCC(Cl)(Cl)Cl)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C6H8Cl3N2O3S.CHF3O3S/c1-10-2-3-11(5-10)15(12,13)14-4-6(7,8)9;2-1(3,4)8(5,6)7/h2-3,5H,4H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | RCNDUSSSXMVXGQ-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 109.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|