C13H22N2S — CID 115629138
(E)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]pent-3-en-1-amine (PubChem CID 115629138) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is (E)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]pent-3-en-1-amine.
| Compound Name | (E)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]pent-3-en-1-amine |
|---|---|
| PubChem CID | 115629138 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (E)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]pent-3-en-1-amine |
| SMILES | C/C=C/CCNCc1cnc(C(C)(C)C)s1 |
| InChI | InChI=1S/C13H22N2S/c1-5-6-7-8-14-9-11-10-15-12(16-11)13(2,3)4/h5-6,10,14H,7-9H2,1-4H3/b6-5+ |
| InChIKey | XIOOHOQSIRXOHS-AATRIKPKSA-N |
| XLogP | 3.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|