C27H29F15O3 — CID 11563817
(E,2R,6R,7S)-2,6-dimethyl-7-[[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecoxy)phenyl]methoxy]oct-4-enal (PubChem CID 11563817) has the molecular formula C27H29F15O3 and a molecular weight of 686.50 g/mol. Its IUPAC name is (E,2R,6R,7S)-2,6-dimethyl-7-[[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecoxy)phenyl]methoxy]oct-4-enal.
| Compound Name | (E,2R,6R,7S)-2,6-dimethyl-7-[[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecoxy)phenyl]methoxy]oct-4-enal |
|---|---|
| PubChem CID | 11563817 |
| Molecular Formula | C27H29F15O3 |
| Molecular Weight | 686.50 g/mol |
| Exact Mass | 686.19 |
| IUPAC Name | (E,2R,6R,7S)-2,6-dimethyl-7-[[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecoxy)phenyl]methoxy]oct-4-enal |
| SMILES | C[C@H](/C=C/C[C@@H](C)C=O)[C@H](C)OCc1ccc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H29F15O3/c1-16(14-43)6-4-7-17(2)18(3)45-15-19-8-10-20(11-9-19)44-13-5-12-21(28,29)22(30,31)23(32,33)24(34,35)25(36,37)26(38,39)27(40,41)42/h4,7-11,14,16-18H,5-6,12-13,15H2,1-3H3/b7-4+/t16-,17-,18+/m1/s1 |
| InChIKey | LPGYSUPTTZBARF-FNNKVKJLSA-N |
| XLogP | 9.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.50 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|