C35H53F9O3Si — CID 11714650
tert-butyl-dimethyl-[(2S,4E,6R,8E,10S,11S)-2,6,10-trimethyl-11-[[4-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)phenyl]methoxy]dodeca-4,8-dienoxy]silane (PubChem CID 11714650) has the molecular formula C35H53F9O3Si and a molecular weight of 720.87 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2S,4E,6R,8E,10S,11S)-2,6,10-trimethyl-11-[[4-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)phenyl]methoxy]dodeca-4,8-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2S,4E,6R,8E,10S,11S)-2,6,10-trimethyl-11-[[4-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)phenyl]methoxy]dodeca-4,8-dienoxy]silane |
|---|---|
| PubChem CID | 11714650 |
| Molecular Formula | C35H53F9O3Si |
| Molecular Weight | 720.87 g/mol |
| Exact Mass | 720.36 |
| IUPAC Name | tert-butyl-dimethyl-[(2S,4E,6R,8E,10S,11S)-2,6,10-trimethyl-11-[[4-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)phenyl]methoxy]dodeca-4,8-dienoxy]silane |
| SMILES | C[C@@H](C/C=C/[C@H](C)C/C=C/[C@H](C)[C@H](C)OCc1ccc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H53F9O3Si/c1-25(13-10-15-26(2)23-47-48(8,9)31(5,6)7)14-11-16-27(3)28(4)46-24-29-17-19-30(20-18-29)45-22-12-21-32(36,37)33(38,39)34(40,41)35(42,43)44/h10-11,13,16-20,25-28H,12,14-15,21-24H2,1-9H3/b13-10+,16-11+/t25-,26-,27-,28-/m0/s1 |
| InChIKey | BISLEBAYRWOAEF-PGBXSEHYSA-N |
| XLogP | 12.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.87 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|