C33H39F15O2 — CID 11629163
1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecoxy)-4-[[(2R,3S,4E,7S,8E,11S)-3,7,11-trimethyltrideca-4,8,12-trien-2-yl]oxymethyl]benzene (PubChem CID 11629163) has the molecular formula C33H39F15O2 and a molecular weight of 752.64 g/mol. Its IUPAC name is 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecoxy)-4-[[(2R,3S,4E,7S,8E,11S)-3,7,11-trimethyltrideca-4,8,12-trien-2-yl]oxymethyl]benzene.
| Compound Name | 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecoxy)-4-[[(2R,3S,4E,7S,8E,11S)-3,7,11-trimethyltrideca-4,8,12-trien-2-yl]oxymethyl]benzene |
|---|---|
| PubChem CID | 11629163 |
| Molecular Formula | C33H39F15O2 |
| Molecular Weight | 752.64 g/mol |
| Exact Mass | 752.27 |
| IUPAC Name | 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecoxy)-4-[[(2R,3S,4E,7S,8E,11S)-3,7,11-trimethyltrideca-4,8,12-trien-2-yl]oxymethyl]benzene |
| SMILES | C=C[C@@H](C)C/C=C/[C@@H](C)C/C=C/[C@H](C)[C@@H](C)OCc1ccc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H39F15O2/c1-6-21(2)10-7-11-22(3)12-8-13-23(4)24(5)50-20-25-14-16-26(17-15-25)49-19-9-18-27(34,35)28(36,37)29(38,39)30(40,41)31(42,43)32(44,45)33(46,47)48/h6-8,11,13-17,21-24H,1,9-10,12,18-20H2,2-5H3/b11-7+,13-8+/t21-,22-,23+,24-/m1/s1 |
| InChIKey | OUUXCXUBSOIJGL-HMHWMSBLSA-N |
| XLogP | 12.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.64 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|