C12H19N3O4S — CID 115664874
1-methyl-N-[1-(oxolan-3-yl)ethyl]-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 115664874) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is 1-methyl-N-[1-(oxolan-3-yl)ethyl]-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | 1-methyl-N-[1-(oxolan-3-yl)ethyl]-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 115664874 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 1-methyl-N-[1-(oxolan-3-yl)ethyl]-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | CC(NC(=O)c1cc(S(N)(=O)=O)cn1C)C1CCOC1 |
| InChI | InChI=1S/C12H19N3O4S/c1-8(9-3-4-19-7-9)14-12(16)11-5-10(6-15(11)2)20(13,17)18/h5-6,8-9H,3-4,7H2,1-2H3,(H,14,16)(H2,13,17,18) |
| InChIKey | MGFZRDOOGFIJGY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |