C14H15Cl2N3O — CID 115680816
3-(2,4-dichlorophenyl)-N-(4-ethyl-1H-pyrazol-5-yl)propanamide (PubChem CID 115680816) has the molecular formula C14H15Cl2N3O and a molecular weight of 312.20 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-(4-ethyl-1H-pyrazol-5-yl)propanamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-(4-ethyl-1H-pyrazol-5-yl)propanamide |
|---|---|
| PubChem CID | 115680816 |
| Molecular Formula | C14H15Cl2N3O |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-(4-ethyl-1H-pyrazol-5-yl)propanamide |
| SMILES | CCc1cn[nH]c1NC(=O)CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl2N3O/c1-2-9-8-17-19-14(9)18-13(20)6-4-10-3-5-11(15)7-12(10)16/h3,5,7-8H,2,4,6H2,1H3,(H2,17,18,19,20) |
| InChIKey | MZITWTYKLLVEHZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |