C26H39NO6SSi2 — CID 11570268
(1R,2S,3S,4S,4aR,10bR)-5-(4-methylphenyl)sulfonyl-8,9-bis(trimethylsilyl)-2,3,4,4a,6,10b-hexahydro-1H-phenanthridine-1,2,3,4-tetrol (PubChem CID 11570268) has the molecular formula C26H39NO6SSi2 and a molecular weight of 549.84 g/mol. Its IUPAC name is (1R,2S,3S,4S,4aR,10bR)-5-(4-methylphenyl)sulfonyl-8,9-bis(trimethylsilyl)-2,3,4,4a,6,10b-hexahydro-1H-phenanthridine-1,2,3,4-tetrol.
| Compound Name | (1R,2S,3S,4S,4aR,10bR)-5-(4-methylphenyl)sulfonyl-8,9-bis(trimethylsilyl)-2,3,4,4a,6,10b-hexahydro-1H-phenanthridine-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 11570268 |
| Molecular Formula | C26H39NO6SSi2 |
| Molecular Weight | 549.84 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | (1R,2S,3S,4S,4aR,10bR)-5-(4-methylphenyl)sulfonyl-8,9-bis(trimethylsilyl)-2,3,4,4a,6,10b-hexahydro-1H-phenanthridine-1,2,3,4-tetrol |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3cc([Si](C)(C)C)c([Si](C)(C)C)cc3[C@H]3[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@@H]32)cc1 |
| InChI | InChI=1S/C26H39NO6SSi2/c1-15-8-10-17(11-9-15)34(32,33)27-14-16-12-19(35(2,3)4)20(36(5,6)7)13-18(16)21-22(27)24(29)26(31)25(30)23(21)28/h8-13,21-26,28-31H,14H2,1-7H3/t21-,22-,23-,24+,25+,26+/m1/s1 |
| InChIKey | NFYPNJPYPIYQGW-CXYTZJNRSA-N |
| XLogP | 1.20 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.84 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|