C11H11IN2OS2 — CID 1157124
(12S)-12-(iodomethyl)-4,5-dimethyl-3,10-dithia-1,8-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,8-trien-7-one (PubChem CID 1157124) has the molecular formula C11H11IN2OS2 and a molecular weight of 378.26 g/mol. Its IUPAC name is (12S)-12-(iodomethyl)-4,5-dimethyl-3,10-dithia-1,8-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,8-trien-7-one.
| Compound Name | (12S)-12-(iodomethyl)-4,5-dimethyl-3,10-dithia-1,8-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,8-trien-7-one |
|---|---|
| PubChem CID | 1157124 |
| Molecular Formula | C11H11IN2OS2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.94 |
| IUPAC Name | (12S)-12-(iodomethyl)-4,5-dimethyl-3,10-dithia-1,8-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,8-trien-7-one |
| SMILES | Cc1sc2c(c1C)c(=O)nc1n2[C@H](CI)CS1 |
| InChI | InChI=1S/C11H11IN2OS2/c1-5-6(2)17-10-8(5)9(15)13-11-14(10)7(3-12)4-16-11/h7H,3-4H2,1-2H3/t7-/m1/s1 |
| InChIKey | AMCQIWVXHLDILK-SSDOTTSWSA-N |
| XLogP | 3.16 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|