C12H10N2O3S2 — CID 962641
2-(4,5-dimethyl-7-oxo-3,10-dithia-1,8-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,8,11-tetraen-12-yl)acetic acid (PubChem CID 962641) has the molecular formula C12H10N2O3S2 and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-(4,5-dimethyl-7-oxo-3,10-dithia-1,8-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,8,11-tetraen-12-yl)acetic acid.
| Compound Name | 2-(4,5-dimethyl-7-oxo-3,10-dithia-1,8-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,8,11-tetraen-12-yl)acetic acid |
|---|---|
| PubChem CID | 962641 |
| Molecular Formula | C12H10N2O3S2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 2-(4,5-dimethyl-7-oxo-3,10-dithia-1,8-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,8,11-tetraen-12-yl)acetic acid |
| SMILES | Cc1sc2c(c1C)c(=O)nc1scc(CC(=O)O)n12 |
| InChI | InChI=1S/C12H10N2O3S2/c1-5-6(2)19-11-9(5)10(17)13-12-14(11)7(4-18-12)3-8(15)16/h4H,3H2,1-2H3,(H,15,16) |
| InChIKey | OOALZYFFCGEVRF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |