C10H15N3O — CID 115742288
N-(3,6-dihydro-2H-pyran-5-ylmethyl)-1-methylpyrazol-3-amine (PubChem CID 115742288) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-5-ylmethyl)-1-methylpyrazol-3-amine.
| Compound Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-1-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 115742288 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-1-methylpyrazol-3-amine |
| SMILES | Cn1ccc(NCC2=CCCOC2)n1 |
| InChI | InChI=1S/C10H15N3O/c1-13-5-4-10(12-13)11-7-9-3-2-6-14-8-9/h3-5H,2,6-8H2,1H3,(H,11,12) |
| InChIKey | FWXKACJFNVVMQH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|