C18H30O2 — CID 115798125
2-(3,5-dimethyl-1-adamantyl)-1-(oxolan-3-yl)ethanol (PubChem CID 115798125) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-adamantyl)-1-(oxolan-3-yl)ethanol.
| Compound Name | 2-(3,5-dimethyl-1-adamantyl)-1-(oxolan-3-yl)ethanol |
|---|---|
| PubChem CID | 115798125 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 2-(3,5-dimethyl-1-adamantyl)-1-(oxolan-3-yl)ethanol |
| SMILES | CC12CC3CC(C)(C1)CC(CC(O)C1CCOC1)(C3)C2 |
| InChI | InChI=1S/C18H30O2/c1-16-5-13-6-17(2,10-16)12-18(7-13,11-16)8-15(19)14-3-4-20-9-14/h13-15,19H,3-12H2,1-2H3 |
| InChIKey | JHVAAHWOZPFMFH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |