C20H37N — CID 114981869
1-(3,5-dimethyl-1-adamantyl)-N-propylpentan-2-amine (PubChem CID 114981869) has the molecular formula C20H37N and a molecular weight of 291.52 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-adamantyl)-N-propylpentan-2-amine.
| Compound Name | 1-(3,5-dimethyl-1-adamantyl)-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 114981869 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | 1-(3,5-dimethyl-1-adamantyl)-N-propylpentan-2-amine |
| SMILES | CCCNC(CCC)CC12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C20H37N/c1-5-7-17(21-8-6-2)12-20-11-16-9-18(3,14-20)13-19(4,10-16)15-20/h16-17,21H,5-15H2,1-4H3 |
| InChIKey | QGLHPLZNNJLSRI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |