C19H31N — CID 115819782
1-(3,5-dimethyl-1-adamantyl)-N-methylhex-4-yn-2-amine (PubChem CID 115819782) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-adamantyl)-N-methylhex-4-yn-2-amine.
| Compound Name | 1-(3,5-dimethyl-1-adamantyl)-N-methylhex-4-yn-2-amine |
|---|---|
| PubChem CID | 115819782 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 1-(3,5-dimethyl-1-adamantyl)-N-methylhex-4-yn-2-amine |
| SMILES | CC#CCC(CC12CC3CC(C)(CC(C)(C3)C1)C2)NC |
| InChI | InChI=1S/C19H31N/c1-5-6-7-16(20-4)11-19-10-15-8-17(2,13-19)12-18(3,9-15)14-19/h15-16,20H,7-14H2,1-4H3 |
| InChIKey | OKYMLTVOPREIQQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|