C17H32N2 — CID 105281772
[1-(3,5-dimethyl-1-adamantyl)-3-methylbutan-2-yl]hydrazine (PubChem CID 105281772) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is [1-(3,5-dimethyl-1-adamantyl)-3-methylbutan-2-yl]hydrazine.
| Compound Name | [1-(3,5-dimethyl-1-adamantyl)-3-methylbutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105281772 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | [1-(3,5-dimethyl-1-adamantyl)-3-methylbutan-2-yl]hydrazine |
| SMILES | CC(C)C(CC12CC3CC(C)(CC(C)(C3)C1)C2)NN |
| InChI | InChI=1S/C17H32N2/c1-12(2)14(19-18)8-17-7-13-5-15(3,10-17)9-16(4,6-13)11-17/h12-14,19H,5-11,18H2,1-4H3 |
| InChIKey | UUTPSRJUGGKICD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|