About 1-(3,5-dimethyl-1-adamantyl)-3,3-dimethylbutan-2-ol
1-(3,5-dimethyl-1-adamantyl)-3,3-dimethylbutan-2-ol (PubChem CID 115796460) has the molecular formula C18H32O
and a molecular weight of 264.45 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-adamantyl)-3,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | 1-(3,5-dimethyl-1-adamantyl)-3,3-dimethylbutan-2-ol |
| PubChem CID | 115796460 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | 1-(3,5-dimethyl-1-adamantyl)-3,3-dimethylbutan-2-ol |
| SMILES | CC12CC3CC(C)(C1)CC(CC(O)C(C)(C)C)(C3)C2 |
| InChI | InChI=1S/C18H32O/c1-15(2,3)14(19)9-18-8-13-6-16(4,11-18)10-17(5,7-13)12-18/h13-14,19H,6-12H2,1-5H3 |
| InChIKey | NQJORHJVTMYJCQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3,5-dimethyl-1-adamantyl)-3,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethyl-1-adamantyl)-3,3-dimethylbutan-2-ol?
The IUPAC name of 1-(3,5-dimethyl-1-adamantyl)-3,3-dimethylbutan-2-ol (CID 115796460) is 1-(3,5-dimethyl-1-adamantyl)-3,3-dimethylbutan-2-ol.
What is the SMILES notation for 1-(3,5-dimethyl-1-adamantyl)-3,3-dimethylbutan-2-ol?
The canonical SMILES for 1-(3,5-dimethyl-1-adamantyl)-3,3-dimethylbutan-2-ol is CC12CC3CC(C)(C1)CC(CC(O)C(C)(C)C)(C3)C2.
What is the InChIKey of 1-(3,5-dimethyl-1-adamantyl)-3,3-dimethylbutan-2-ol?
The InChIKey is NQJORHJVTMYJCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O/c1-15(2,3)14(19)9-18-8-13-6-16(4,11-18)10-17(5,7-13)12-18/h13-14,19H,6-12H2,1-5H3.
What are the key properties of 1-(3,5-dimethyl-1-adamantyl)-3,3-dimethylbutan-2-ol?
1-(3,5-dimethyl-1-adamantyl)-3,3-dimethylbutan-2-ol has a molecular weight of 264.45 g/mol, XLogP of 4.78, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethyl-1-adamantyl)-3,3-dimethylbutan-2-ol is sourced from PubChem (CID 115796460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).