C9H5F3O — CID 115811100
1-(2,3,4-trifluorophenyl)prop-2-yn-1-ol (PubChem CID 115811100) has the molecular formula C9H5F3O and a molecular weight of 186.13 g/mol. Its IUPAC name is 1-(2,3,4-trifluorophenyl)prop-2-yn-1-ol.
| Compound Name | 1-(2,3,4-trifluorophenyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 115811100 |
| Molecular Formula | C9H5F3O |
| Molecular Weight | 186.13 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 1-(2,3,4-trifluorophenyl)prop-2-yn-1-ol |
| SMILES | C#CC(O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C9H5F3O/c1-2-7(13)5-3-4-6(10)9(12)8(5)11/h1,3-4,7,13H |
| InChIKey | JSYBUBBTPCMBKG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.13 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|