C9H6F2O — CID 130563244
(1R)-1-(2,6-difluorophenyl)prop-2-yn-1-ol (PubChem CID 130563244) has the molecular formula C9H6F2O and a molecular weight of 168.14 g/mol. Its IUPAC name is (1R)-1-(2,6-difluorophenyl)prop-2-yn-1-ol.
| Compound Name | (1R)-1-(2,6-difluorophenyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 130563244 |
| Molecular Formula | C9H6F2O |
| Molecular Weight | 168.14 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | (1R)-1-(2,6-difluorophenyl)prop-2-yn-1-ol |
| SMILES | C#C[C@@H](O)c1c(F)cccc1F |
| InChI | InChI=1S/C9H6F2O/c1-2-8(12)9-6(10)4-3-5-7(9)11/h1,3-5,8,12H/t8-/m1/s1 |
| InChIKey | CIBMTAAXRLQQOC-MRVPVSSYSA-N |
| XLogP | 1.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.14 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|