C15H21BrOS — CID 115820008
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(4-bromothiophen-3-yl)methanol (PubChem CID 115820008) has the molecular formula C15H21BrOS and a molecular weight of 329.30 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(4-bromothiophen-3-yl)methanol.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(4-bromothiophen-3-yl)methanol |
|---|---|
| PubChem CID | 115820008 |
| Molecular Formula | C15H21BrOS |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(4-bromothiophen-3-yl)methanol |
| SMILES | OC(c1cscc1Br)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C15H21BrOS/c16-14-9-18-8-13(14)15(17)12-6-5-10-3-1-2-4-11(10)7-12/h8-12,15,17H,1-7H2 |
| InChIKey | RYTFSROLKFVUQK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |