C14H19NO — CID 115825472
1,3-dimethyl-2,3,4,4a,10,10a-hexahydro-1H-phenoxazine (PubChem CID 115825472) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 1,3-dimethyl-2,3,4,4a,10,10a-hexahydro-1H-phenoxazine.
| Compound Name | 1,3-dimethyl-2,3,4,4a,10,10a-hexahydro-1H-phenoxazine |
|---|---|
| PubChem CID | 115825472 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1,3-dimethyl-2,3,4,4a,10,10a-hexahydro-1H-phenoxazine |
| SMILES | CC1CC(C)C2Nc3ccccc3OC2C1 |
| InChI | InChI=1S/C14H19NO/c1-9-7-10(2)14-13(8-9)16-12-6-4-3-5-11(12)15-14/h3-6,9-10,13-15H,7-8H2,1-2H3 |
| InChIKey | TYCILWTYHFMVQB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |