C8H9NOS — CID 142926146
2-methylsulfanyl-2,3-dihydro-1,3-benzoxazole (PubChem CID 142926146) has the molecular formula C8H9NOS and a molecular weight of 167.23 g/mol. Its IUPAC name is 2-methylsulfanyl-2,3-dihydro-1,3-benzoxazole.
| Compound Name | 2-methylsulfanyl-2,3-dihydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 142926146 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 2-methylsulfanyl-2,3-dihydro-1,3-benzoxazole |
| SMILES | CSC1Nc2ccccc2O1 |
| InChI | InChI=1S/C8H9NOS/c1-11-8-9-6-4-2-3-5-7(6)10-8/h2-5,8-9H,1H3 |
| InChIKey | MSKMAJZVEPAOGU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |