C7H8N2O2 — CID 13004329
N-(2,3-dihydro-1,3-benzoxazol-2-yl)hydroxylamine (PubChem CID 13004329) has the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. Its IUPAC name is N-(2,3-dihydro-1,3-benzoxazol-2-yl)hydroxylamine.
| Compound Name | N-(2,3-dihydro-1,3-benzoxazol-2-yl)hydroxylamine |
|---|---|
| PubChem CID | 13004329 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | N-(2,3-dihydro-1,3-benzoxazol-2-yl)hydroxylamine |
| SMILES | ONC1Nc2ccccc2O1 |
| InChI | InChI=1S/C7H8N2O2/c10-9-7-8-5-3-1-2-4-6(5)11-7/h1-4,7-10H |
| InChIKey | RMCCNWYQVKGTHG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|