C46H56O7Si — CID 11585786
(2S,3S,5R,7R,9S,15S)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-15-methyl-2-phenylmethoxy-3-(2-phenylmethoxyethyl)-4,6,8-trioxadispiro[4.1.57.35]pentadecan-11-one (PubChem CID 11585786) has the molecular formula C46H56O7Si and a molecular weight of 749.03 g/mol. Its IUPAC name is (2S,3S,5R,7R,9S,15S)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-15-methyl-2-phenylmethoxy-3-(2-phenylmethoxyethyl)-4,6,8-trioxadispiro[4.1.57.35]pentadecan-11-one.
| Compound Name | (2S,3S,5R,7R,9S,15S)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-15-methyl-2-phenylmethoxy-3-(2-phenylmethoxyethyl)-4,6,8-trioxadispiro[4.1.57.35]pentadecan-11-one |
|---|---|
| PubChem CID | 11585786 |
| Molecular Formula | C46H56O7Si |
| Molecular Weight | 749.03 g/mol |
| Exact Mass | 748.38 |
| IUPAC Name | (2S,3S,5R,7R,9S,15S)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-15-methyl-2-phenylmethoxy-3-(2-phenylmethoxyethyl)-4,6,8-trioxadispiro[4.1.57.35]pentadecan-11-one |
| SMILES | C[C@H]1CC[C@]2(CC(=O)C[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)O[C@]12C[C@H](OCc1ccccc1)[C@H](CCOCc1ccccc1)O2 |
| InChI | InChI=1S/C46H56O7Si/c1-35-25-27-45(30-38(47)29-39(51-45)34-50-54(44(2,3)4,40-21-13-7-14-22-40)41-23-15-8-16-24-41)53-46(35)31-43(49-33-37-19-11-6-12-20-37)42(52-46)26-28-48-32-36-17-9-5-10-18-36/h5-24,35,39,42-43H,25-34H2,1-4H3/t35-,39-,42-,43-,45+,46+/m0/s1 |
| InChIKey | SVNFULPSEYKMEY-GNVDIVQSSA-N |
| XLogP | 8.13 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.03 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|