C12H23N3 — CID 115888352
N-[1-(4,5-dimethylimidazol-1-yl)propan-2-yl]butan-1-amine (PubChem CID 115888352) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is N-[1-(4,5-dimethylimidazol-1-yl)propan-2-yl]butan-1-amine.
| Compound Name | N-[1-(4,5-dimethylimidazol-1-yl)propan-2-yl]butan-1-amine |
|---|---|
| PubChem CID | 115888352 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | N-[1-(4,5-dimethylimidazol-1-yl)propan-2-yl]butan-1-amine |
| SMILES | CCCCNC(C)Cn1cnc(C)c1C |
| InChI | InChI=1S/C12H23N3/c1-5-6-7-13-10(2)8-15-9-14-11(3)12(15)4/h9-10,13H,5-8H2,1-4H3 |
| InChIKey | DZSHRJQYQDHEBL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|