About 1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine
1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine (PubChem CID 130987277) has the molecular formula C8H16N4
and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine.
Molecular Properties
| Compound Name | 1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine |
| PubChem CID | 130987277 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine |
| SMILES | Cc1ncn(CC(C)NN)c1C |
| InChI | InChI=1S/C8H16N4/c1-6(11-9)4-12-5-10-7(2)8(12)3/h5-6,11H,4,9H2,1-3H3 |
| InChIKey | SUQXZZXLQRWXOE-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine?
The IUPAC name of 1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine (CID 130987277) is 1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine.
What is the SMILES notation for 1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine?
The canonical SMILES for 1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine is Cc1ncn(CC(C)NN)c1C.
What is the InChIKey of 1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine?
The InChIKey is SUQXZZXLQRWXOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4/c1-6(11-9)4-12-5-10-7(2)8(12)3/h5-6,11H,4,9H2,1-3H3.
What are the key properties of 1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine?
1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine has a molecular weight of 168.24 g/mol, XLogP of 0.35, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine is sourced from PubChem (CID 130987277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).