C8H16N4 — CID 130987277
1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine (PubChem CID 130987277) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine.
| Compound Name | 1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine |
|---|---|
| PubChem CID | 130987277 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 1-(4,5-dimethylimidazol-1-yl)propan-2-ylhydrazine |
| SMILES | Cc1ncn(CC(C)NN)c1C |
| InChI | InChI=1S/C8H16N4/c1-6(11-9)4-12-5-10-7(2)8(12)3/h5-6,11H,4,9H2,1-3H3 |
| InChIKey | SUQXZZXLQRWXOE-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|