C23H28N4O5 — CID 11590291
3,5-dihydroxy-N-methoxy-6-[4-(1-phenylethylamino)quinazolin-6-yl]oxyhexanamide (PubChem CID 11590291) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is 3,5-dihydroxy-N-methoxy-6-[4-(1-phenylethylamino)quinazolin-6-yl]oxyhexanamide.
| Compound Name | 3,5-dihydroxy-N-methoxy-6-[4-(1-phenylethylamino)quinazolin-6-yl]oxyhexanamide |
|---|---|
| PubChem CID | 11590291 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 3,5-dihydroxy-N-methoxy-6-[4-(1-phenylethylamino)quinazolin-6-yl]oxyhexanamide |
| SMILES | CONC(=O)CC(O)CC(O)COc1ccc2ncnc(NC(C)c3ccccc3)c2c1 |
| InChI | InChI=1S/C23H28N4O5/c1-15(16-6-4-3-5-7-16)26-23-20-12-19(8-9-21(20)24-14-25-23)32-13-18(29)10-17(28)11-22(30)27-31-2/h3-9,12,14-15,17-18,28-29H,10-11,13H2,1-2H3,(H,27,30)(H,24,25,26) |
| InChIKey | AVNGOXYORKICQX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 125.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|