C28H28NO2P — CID 11590316
N-[[methyl(phenylmethoxy)phosphoryl]methyl]-1,1,1-triphenylmethanamine (PubChem CID 11590316) has the molecular formula C28H28NO2P and a molecular weight of 441.51 g/mol. Its IUPAC name is N-[[methyl(phenylmethoxy)phosphoryl]methyl]-1,1,1-triphenylmethanamine.
| Compound Name | N-[[methyl(phenylmethoxy)phosphoryl]methyl]-1,1,1-triphenylmethanamine |
|---|---|
| PubChem CID | 11590316 |
| Molecular Formula | C28H28NO2P |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N-[[methyl(phenylmethoxy)phosphoryl]methyl]-1,1,1-triphenylmethanamine |
| SMILES | CP(=O)(CNC(c1ccccc1)(c1ccccc1)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C28H28NO2P/c1-32(30,31-22-24-14-6-2-7-15-24)23-29-28(25-16-8-3-9-17-25,26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-21,29H,22-23H2,1H3 |
| InChIKey | VIEZWHMMMFVOOW-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|