C25H20BrNO4 — CID 11591056
(1S,4S,6S)-6-(4-bromophenyl)-1,2-bis(4-methylphenyl)-5,7-dioxa-2-azaspiro[3.4]octane-3,8-dione (PubChem CID 11591056) has the molecular formula C25H20BrNO4 and a molecular weight of 478.34 g/mol. Its IUPAC name is (1S,4S,6S)-6-(4-bromophenyl)-1,2-bis(4-methylphenyl)-5,7-dioxa-2-azaspiro[3.4]octane-3,8-dione.
| Compound Name | (1S,4S,6S)-6-(4-bromophenyl)-1,2-bis(4-methylphenyl)-5,7-dioxa-2-azaspiro[3.4]octane-3,8-dione |
|---|---|
| PubChem CID | 11591056 |
| Molecular Formula | C25H20BrNO4 |
| Molecular Weight | 478.34 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | (1S,4S,6S)-6-(4-bromophenyl)-1,2-bis(4-methylphenyl)-5,7-dioxa-2-azaspiro[3.4]octane-3,8-dione |
| SMILES | Cc1ccc([C@@H]2N(c3ccc(C)cc3)C(=O)[C@@]23O[C@H](c2ccc(Br)cc2)OC3=O)cc1 |
| InChI | InChI=1S/C25H20BrNO4/c1-15-3-7-17(8-4-15)21-25(23(28)27(21)20-13-5-16(2)6-14-20)24(29)30-22(31-25)18-9-11-19(26)12-10-18/h3-14,21-22H,1-2H3/t21-,22+,25-/m0/s1 |
| InChIKey | RNARQPWRNTZLOW-FBLLAGFSSA-N |
| XLogP | 5.16 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.34 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|