C14H16FN5 — CID 115978112
2-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-4-amine (PubChem CID 115978112) has the molecular formula C14H16FN5 and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-4-amine.
| Compound Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 115978112 |
| Molecular Formula | C14H16FN5 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-4-amine |
| SMILES | Nc1ccnc(N2CCN(c3ccccc3F)CC2)n1 |
| InChI | InChI=1S/C14H16FN5/c15-11-3-1-2-4-12(11)19-7-9-20(10-8-19)14-17-6-5-13(16)18-14/h1-6H,7-10H2,(H2,16,17,18) |
| InChIKey | DZLDEZXRSHUTLE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |