C13H11N3O3S — CID 115979892
5-[(6-amino-1H-benzimidazol-2-yl)sulfanylmethyl]furan-3-carboxylic acid (PubChem CID 115979892) has the molecular formula C13H11N3O3S and a molecular weight of 289.32 g/mol. Its IUPAC name is 5-[(6-amino-1H-benzimidazol-2-yl)sulfanylmethyl]furan-3-carboxylic acid.
| Compound Name | 5-[(6-amino-1H-benzimidazol-2-yl)sulfanylmethyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 115979892 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 5-[(6-amino-1H-benzimidazol-2-yl)sulfanylmethyl]furan-3-carboxylic acid |
| SMILES | Nc1ccc2nc(SCc3cc(C(=O)O)co3)[nH]c2c1 |
| InChI | InChI=1S/C13H11N3O3S/c14-8-1-2-10-11(4-8)16-13(15-10)20-6-9-3-7(5-19-9)12(17)18/h1-5H,6,14H2,(H,15,16)(H,17,18) |
| InChIKey | MKQIZFGLKZIMJH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|