C46H56O7Si — CID 11600222
(2S,9S,12S,13S)-1-[tert-butyl(diphenyl)silyl]oxy-2,13-dihydroxy-9-methyl-12,15-bis(phenylmethoxy)pentadec-5-yne-4,10-dione (PubChem CID 11600222) has the molecular formula C46H56O7Si and a molecular weight of 749.03 g/mol. Its IUPAC name is (2S,9S,12S,13S)-1-[tert-butyl(diphenyl)silyl]oxy-2,13-dihydroxy-9-methyl-12,15-bis(phenylmethoxy)pentadec-5-yne-4,10-dione.
| Compound Name | (2S,9S,12S,13S)-1-[tert-butyl(diphenyl)silyl]oxy-2,13-dihydroxy-9-methyl-12,15-bis(phenylmethoxy)pentadec-5-yne-4,10-dione |
|---|---|
| PubChem CID | 11600222 |
| Molecular Formula | C46H56O7Si |
| Molecular Weight | 749.03 g/mol |
| Exact Mass | 748.38 |
| IUPAC Name | (2S,9S,12S,13S)-1-[tert-butyl(diphenyl)silyl]oxy-2,13-dihydroxy-9-methyl-12,15-bis(phenylmethoxy)pentadec-5-yne-4,10-dione |
| SMILES | C[C@@H](CCC#CC(=O)C[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)C[C@H](OCc1ccccc1)[C@@H](O)CCOCc1ccccc1 |
| InChI | InChI=1S/C46H56O7Si/c1-36(44(50)32-45(52-34-38-22-11-6-12-23-38)43(49)29-30-51-33-37-20-9-5-10-21-37)19-17-18-24-39(47)31-40(48)35-53-54(46(2,3)4,41-25-13-7-14-26-41)42-27-15-8-16-28-42/h5-16,20-23,25-28,36,40,43,45,48-49H,17,19,29-35H2,1-4H3/t36-,40-,43-,45-/m0/s1 |
| InChIKey | KHXSNKBAKNCAJV-SEOVWKDHSA-N |
| XLogP | 6.82 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.03 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|