C33H44O4Si — CID 11432582
(2S,4R,5S,6R)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-2,4,6-trimethyl-1-phenylmethoxyheptan-3-one (PubChem CID 11432582) has the molecular formula C33H44O4Si and a molecular weight of 532.80 g/mol. Its IUPAC name is (2S,4R,5S,6R)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-2,4,6-trimethyl-1-phenylmethoxyheptan-3-one.
| Compound Name | (2S,4R,5S,6R)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-2,4,6-trimethyl-1-phenylmethoxyheptan-3-one |
|---|---|
| PubChem CID | 11432582 |
| Molecular Formula | C33H44O4Si |
| Molecular Weight | 532.80 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | (2S,4R,5S,6R)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-2,4,6-trimethyl-1-phenylmethoxyheptan-3-one |
| SMILES | C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](O)[C@@H](C)C(=O)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C33H44O4Si/c1-25(22-36-24-28-16-10-7-11-17-28)31(34)27(3)32(35)26(2)23-37-38(33(4,5)6,29-18-12-8-13-19-29)30-20-14-9-15-21-30/h7-21,25-27,32,35H,22-24H2,1-6H3/t25-,26+,27-,32-/m0/s1 |
| InChIKey | OYPCFQUZGRWYTC-XTQYNZLPSA-N |
| XLogP | 5.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.80 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|