C32H60O5Si2 — CID 10962922
(2S,3S,4R,7S)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2,4,6,6-tetramethyl-1-phenylmethoxynonan-5-one (PubChem CID 10962922) has the molecular formula C32H60O5Si2 and a molecular weight of 581.00 g/mol. Its IUPAC name is (2S,3S,4R,7S)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2,4,6,6-tetramethyl-1-phenylmethoxynonan-5-one.
| Compound Name | (2S,3S,4R,7S)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2,4,6,6-tetramethyl-1-phenylmethoxynonan-5-one |
|---|---|
| PubChem CID | 10962922 |
| Molecular Formula | C32H60O5Si2 |
| Molecular Weight | 581.00 g/mol |
| Exact Mass | 580.40 |
| IUPAC Name | (2S,3S,4R,7S)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2,4,6,6-tetramethyl-1-phenylmethoxynonan-5-one |
| SMILES | C[C@@H](COCc1ccccc1)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H60O5Si2/c1-24(22-35-23-26-18-16-15-17-19-26)28(33)25(2)29(34)32(9,10)27(37-39(13,14)31(6,7)8)20-21-36-38(11,12)30(3,4)5/h15-19,24-25,27-28,33H,20-23H2,1-14H3/t24-,25+,27-,28-/m0/s1 |
| InChIKey | RFCOCAKHMRUJHC-XPCWZZLQSA-N |
| XLogP | 8.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.00 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|