C32H42O4Si — CID 11168321
(2S,4R,5R,6S)-6-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-2,4-dimethyl-1-phenylmethoxyheptan-3-one (PubChem CID 11168321) has the molecular formula C32H42O4Si and a molecular weight of 518.77 g/mol. Its IUPAC name is (2S,4R,5R,6S)-6-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-2,4-dimethyl-1-phenylmethoxyheptan-3-one.
| Compound Name | (2S,4R,5R,6S)-6-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-2,4-dimethyl-1-phenylmethoxyheptan-3-one |
|---|---|
| PubChem CID | 11168321 |
| Molecular Formula | C32H42O4Si |
| Molecular Weight | 518.77 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | (2S,4R,5R,6S)-6-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-2,4-dimethyl-1-phenylmethoxyheptan-3-one |
| SMILES | C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](O)[C@@H](C)C(=O)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C32H42O4Si/c1-24(22-35-23-27-16-10-7-11-17-27)30(33)25(2)31(34)26(3)36-37(32(4,5)6,28-18-12-8-13-19-28)29-20-14-9-15-21-29/h7-21,24-26,31,34H,22-23H2,1-6H3/t24-,25-,26-,31+/m0/s1 |
| InChIKey | QIQKDLSODKPGKP-WJQRCLFPSA-N |
| XLogP | 5.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.77 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|