C42H64O4Si2 — CID 11767630
(4S,5R,6S,9R)-4-[tert-butyl(dimethyl)silyl]oxy-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-6-phenylmethoxyundecan-2-one (PubChem CID 11767630) has the molecular formula C42H64O4Si2 and a molecular weight of 689.14 g/mol. Its IUPAC name is (4S,5R,6S,9R)-4-[tert-butyl(dimethyl)silyl]oxy-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-6-phenylmethoxyundecan-2-one.
| Compound Name | (4S,5R,6S,9R)-4-[tert-butyl(dimethyl)silyl]oxy-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-6-phenylmethoxyundecan-2-one |
|---|---|
| PubChem CID | 11767630 |
| Molecular Formula | C42H64O4Si2 |
| Molecular Weight | 689.14 g/mol |
| Exact Mass | 688.43 |
| IUPAC Name | (4S,5R,6S,9R)-4-[tert-butyl(dimethyl)silyl]oxy-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-6-phenylmethoxyundecan-2-one |
| SMILES | CC[C@H](CC[C@H](OCc1ccccc1)[C@@H](C)[C@H](CC(C)=O)O[Si](C)(C)C(C)(C)C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C42H64O4Si2/c1-12-35(32-45-48(42(7,8)9,37-24-18-14-19-25-37)38-26-20-15-21-27-38)28-29-39(44-31-36-22-16-13-17-23-36)34(3)40(30-33(2)43)46-47(10,11)41(4,5)6/h13-27,34-35,39-40H,12,28-32H2,1-11H3/t34-,35-,39+,40+/m1/s1 |
| InChIKey | DUJWZFDYTYQXGO-WXHPKRHJSA-N |
| XLogP | 9.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.14 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|