C43H70O7Si2 — CID 11422809
(1S,4S,5R,6R)-4-hydroxy-5-methyl-1-[(2R,3S,4S)-3-methyl-4-triethylsilyloxy-3,4-dihydro-2H-pyran-2-yl]-1,10-bis(phenylmethoxy)-6-triethylsilyloxydecan-2-one (PubChem CID 11422809) has the molecular formula C43H70O7Si2 and a molecular weight of 755.20 g/mol. Its IUPAC name is (1S,4S,5R,6R)-4-hydroxy-5-methyl-1-[(2R,3S,4S)-3-methyl-4-triethylsilyloxy-3,4-dihydro-2H-pyran-2-yl]-1,10-bis(phenylmethoxy)-6-triethylsilyloxydecan-2-one.
| Compound Name | (1S,4S,5R,6R)-4-hydroxy-5-methyl-1-[(2R,3S,4S)-3-methyl-4-triethylsilyloxy-3,4-dihydro-2H-pyran-2-yl]-1,10-bis(phenylmethoxy)-6-triethylsilyloxydecan-2-one |
|---|---|
| PubChem CID | 11422809 |
| Molecular Formula | C43H70O7Si2 |
| Molecular Weight | 755.20 g/mol |
| Exact Mass | 754.47 |
| IUPAC Name | (1S,4S,5R,6R)-4-hydroxy-5-methyl-1-[(2R,3S,4S)-3-methyl-4-triethylsilyloxy-3,4-dihydro-2H-pyran-2-yl]-1,10-bis(phenylmethoxy)-6-triethylsilyloxydecan-2-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1C=CO[C@@H]([C@H](OCc2ccccc2)C(=O)C[C@H](O)[C@@H](C)[C@@H](CCCCOCc2ccccc2)O[Si](CC)(CC)CC)[C@@H]1C |
| InChI | InChI=1S/C43H70O7Si2/c1-9-51(10-2,11-3)49-40(27-21-22-29-46-32-36-23-17-15-18-24-36)34(7)38(44)31-39(45)43(48-33-37-25-19-16-20-26-37)42-35(8)41(28-30-47-42)50-52(12-4,13-5)14-6/h15-20,23-26,28,30,34-35,38,40-44H,9-14,21-22,27,29,31-33H2,1-8H3/t34-,35-,38+,40-,41+,42-,43-/m1/s1 |
| InChIKey | SMFOLPMEZSBMOQ-VGDPQATFSA-N |
| XLogP | 10.24 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.20 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|