C39H54O7Si — CID 11285292
(2R,3R,5R,6S,8R)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-5-[(4-methoxyphenyl)methoxy]-4,4,8-trimethyl-2,6-bis(phenylmethoxy)cyclooctan-1-one (PubChem CID 11285292) has the molecular formula C39H54O7Si and a molecular weight of 662.94 g/mol. Its IUPAC name is (2R,3R,5R,6S,8R)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-5-[(4-methoxyphenyl)methoxy]-4,4,8-trimethyl-2,6-bis(phenylmethoxy)cyclooctan-1-one.
| Compound Name | (2R,3R,5R,6S,8R)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-5-[(4-methoxyphenyl)methoxy]-4,4,8-trimethyl-2,6-bis(phenylmethoxy)cyclooctan-1-one |
|---|---|
| PubChem CID | 11285292 |
| Molecular Formula | C39H54O7Si |
| Molecular Weight | 662.94 g/mol |
| Exact Mass | 662.36 |
| IUPAC Name | (2R,3R,5R,6S,8R)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-5-[(4-methoxyphenyl)methoxy]-4,4,8-trimethyl-2,6-bis(phenylmethoxy)cyclooctan-1-one |
| SMILES | COc1ccc(CO[C@H]2[C@@H](OCc3ccccc3)C(O)[C@@H](C)C(=O)[C@H](OCc3ccccc3)[C@H](O[Si](C)(C)C(C)(C)C)C2(C)C)cc1 |
| InChI | InChI=1S/C39H54O7Si/c1-27-32(40)34(43-24-28-16-12-10-13-17-28)36(45-26-30-20-22-31(42-7)23-21-30)39(5,6)37(46-47(8,9)38(2,3)4)35(33(27)41)44-25-29-18-14-11-15-19-29/h10-23,27,32,34-37,40H,24-26H2,1-9H3/t27-,32?,34+,35+,36+,37+/m1/s1 |
| InChIKey | UQVTXBGHBRUFTG-UEWGMYBXSA-N |
| XLogP | 7.75 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.94 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|