C22H28N4OSi — CID 11603551
(1R,4S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-5-methyl-7-prop-1-en-2-ylbicyclo[2.2.2]oct-5-ene-2,2,3,3-tetracarbonitrile (PubChem CID 11603551) has the molecular formula C22H28N4OSi and a molecular weight of 392.58 g/mol. Its IUPAC name is (1R,4S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-5-methyl-7-prop-1-en-2-ylbicyclo[2.2.2]oct-5-ene-2,2,3,3-tetracarbonitrile.
| Compound Name | (1R,4S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-5-methyl-7-prop-1-en-2-ylbicyclo[2.2.2]oct-5-ene-2,2,3,3-tetracarbonitrile |
|---|---|
| PubChem CID | 11603551 |
| Molecular Formula | C22H28N4OSi |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (1R,4S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-5-methyl-7-prop-1-en-2-ylbicyclo[2.2.2]oct-5-ene-2,2,3,3-tetracarbonitrile |
| SMILES | C=C(C)[C@@H]1C[C@@H]2C(C)=C(O[Si](C)(C)C(C)(C)C)[C@H]1C(C#N)(C#N)C2(C#N)C#N |
| InChI | InChI=1S/C22H28N4OSi/c1-14(2)16-9-17-15(3)19(27-28(7,8)20(4,5)6)18(16)22(12-25,13-26)21(17,10-23)11-24/h16-18H,1,9H2,2-8H3/t16-,17+,18-/m0/s1 |
| InChIKey | LJISFWHMEGNYKG-KSZLIROESA-N |
| XLogP | 5.19 |
| TPSA | 104.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|