C28H51NO3Si2 — CID 122401895
(2S)-2-[(1S,5R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methylcyclopent-2-en-1-yl]-2-[(1S)-1-hydroxyprop-2-enyl]-5-methylhex-5-enenitrile (PubChem CID 122401895) has the molecular formula C28H51NO3Si2 and a molecular weight of 505.89 g/mol. Its IUPAC name is (2S)-2-[(1S,5R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methylcyclopent-2-en-1-yl]-2-[(1S)-1-hydroxyprop-2-enyl]-5-methylhex-5-enenitrile.
| Compound Name | (2S)-2-[(1S,5R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methylcyclopent-2-en-1-yl]-2-[(1S)-1-hydroxyprop-2-enyl]-5-methylhex-5-enenitrile |
|---|---|
| PubChem CID | 122401895 |
| Molecular Formula | C28H51NO3Si2 |
| Molecular Weight | 505.89 g/mol |
| Exact Mass | 505.34 |
| IUPAC Name | (2S)-2-[(1S,5R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methylcyclopent-2-en-1-yl]-2-[(1S)-1-hydroxyprop-2-enyl]-5-methylhex-5-enenitrile |
| SMILES | C=C[C@H](O)[C@@](C#N)(CCC(=C)C)[C@]1(C)C(O[Si](C)(C)C(C)(C)C)=CC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H51NO3Si2/c1-15-22(30)28(20-29,19-18-21(2)3)27(10)23(31-33(11,12)25(4,5)6)16-17-24(27)32-34(13,14)26(7,8)9/h15-16,22,24,30H,1-2,17-19H2,3-14H3/t22-,24+,27+,28-/m0/s1 |
| InChIKey | OEHJUPNPMZJCLQ-QJGCUMMJSA-N |
| XLogP | 8.11 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.89 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|