C24H40O4Si — CID 11069846
(1R,2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(1S,3E)-1-hydroxy-4-methylhexa-3,5-dienyl]-5-methyl-2-prop-1-en-2-yl-6-oxabicyclo[3.2.1]octan-8-one (PubChem CID 11069846) has the molecular formula C24H40O4Si and a molecular weight of 420.67 g/mol. Its IUPAC name is (1R,2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(1S,3E)-1-hydroxy-4-methylhexa-3,5-dienyl]-5-methyl-2-prop-1-en-2-yl-6-oxabicyclo[3.2.1]octan-8-one.
| Compound Name | (1R,2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(1S,3E)-1-hydroxy-4-methylhexa-3,5-dienyl]-5-methyl-2-prop-1-en-2-yl-6-oxabicyclo[3.2.1]octan-8-one |
|---|---|
| PubChem CID | 11069846 |
| Molecular Formula | C24H40O4Si |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | (1R,2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(1S,3E)-1-hydroxy-4-methylhexa-3,5-dienyl]-5-methyl-2-prop-1-en-2-yl-6-oxabicyclo[3.2.1]octan-8-one |
| SMILES | C=C/C(C)=C/C[C@H](O)[C@@]12CO[C@@](C)(C1=O)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2C(=C)C |
| InChI | InChI=1S/C24H40O4Si/c1-11-17(4)12-13-19(25)24-15-27-23(8,21(24)26)20(14-18(24)16(2)3)28-29(9,10)22(5,6)7/h11-12,18-20,25H,1-2,13-15H2,3-10H3/b17-12+/t18-,19+,20+,23-,24+/m1/s1 |
| InChIKey | LNOPRFGOHCQPKC-QGDORGKYSA-N |
| XLogP | 5.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|