C22H30BN3O4 — CID 11603953
N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 11603953) has the molecular formula C22H30BN3O4 and a molecular weight of 411.31 g/mol. Its IUPAC name is N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 11603953 |
| Molecular Formula | C22H30BN3O4 |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CC1(C)OB(c2ccc(C(=O)NC3(C(=O)NCC#N)CCCCC3)cc2)OC1(C)C |
| InChI | InChI=1S/C22H30BN3O4/c1-20(2)21(3,4)30-23(29-20)17-10-8-16(9-11-17)18(27)26-22(12-6-5-7-13-22)19(28)25-15-14-24/h8-11H,5-7,12-13,15H2,1-4H3,(H,25,28)(H,26,27) |
| InChIKey | PBFPMQPGSGVNSO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|