C24H28N6O4S — CID 87953719
4-[4-[4-[[1-(cyanomethylcarbamoyl)cyclohexyl]carbamoyl]phenyl]-1,3-thiazol-2-yl]piperazine-1-carboxylic acid (PubChem CID 87953719) has the molecular formula C24H28N6O4S and a molecular weight of 496.59 g/mol. Its IUPAC name is 4-[4-[4-[[1-(cyanomethylcarbamoyl)cyclohexyl]carbamoyl]phenyl]-1,3-thiazol-2-yl]piperazine-1-carboxylic acid.
| Compound Name | 4-[4-[4-[[1-(cyanomethylcarbamoyl)cyclohexyl]carbamoyl]phenyl]-1,3-thiazol-2-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87953719 |
| Molecular Formula | C24H28N6O4S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 4-[4-[4-[[1-(cyanomethylcarbamoyl)cyclohexyl]carbamoyl]phenyl]-1,3-thiazol-2-yl]piperazine-1-carboxylic acid |
| SMILES | N#CCNC(=O)C1(NC(=O)c2ccc(-c3csc(N4CCN(C(=O)O)CC4)n3)cc2)CCCCC1 |
| InChI | InChI=1S/C24H28N6O4S/c25-10-11-26-21(32)24(8-2-1-3-9-24)28-20(31)18-6-4-17(5-7-18)19-16-35-22(27-19)29-12-14-30(15-13-29)23(33)34/h4-7,16H,1-3,8-9,11-15H2,(H,26,32)(H,28,31)(H,33,34) |
| InChIKey | YGCPOYGAGHXJKC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 138.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|