C33H40N6O4S — CID 87301008
4-[2-(4-morpholin-4-ylpiperazin-1-yl)-1,3-thiazol-4-yl]-N-[1-[2-(2-oxoethylamino)benzoyl]cyclohexyl]benzamide (PubChem CID 87301008) has the molecular formula C33H40N6O4S and a molecular weight of 616.79 g/mol. Its IUPAC name is 4-[2-(4-morpholin-4-ylpiperazin-1-yl)-1,3-thiazol-4-yl]-N-[1-[2-(2-oxoethylamino)benzoyl]cyclohexyl]benzamide.
| Compound Name | 4-[2-(4-morpholin-4-ylpiperazin-1-yl)-1,3-thiazol-4-yl]-N-[1-[2-(2-oxoethylamino)benzoyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 87301008 |
| Molecular Formula | C33H40N6O4S |
| Molecular Weight | 616.79 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | 4-[2-(4-morpholin-4-ylpiperazin-1-yl)-1,3-thiazol-4-yl]-N-[1-[2-(2-oxoethylamino)benzoyl]cyclohexyl]benzamide |
| SMILES | O=CCNc1ccccc1C(=O)C1(NC(=O)c2ccc(-c3csc(N4CCN(N5CCOCC5)CC4)n3)cc2)CCCCC1 |
| InChI | InChI=1S/C33H40N6O4S/c40-21-14-34-28-7-3-2-6-27(28)30(41)33(12-4-1-5-13-33)36-31(42)26-10-8-25(9-11-26)29-24-44-32(35-29)37-15-17-38(18-16-37)39-19-22-43-23-20-39/h2-3,6-11,21,24,34H,1,4-5,12-20,22-23H2,(H,36,42) |
| InChIKey | YCFDWTPBVAIAIS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.79 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|