C13H25NO3Si — CID 11608751
3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-methylidene-1,3-oxazolidin-2-one (PubChem CID 11608751) has the molecular formula C13H25NO3Si and a molecular weight of 271.43 g/mol. Its IUPAC name is 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-methylidene-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-methylidene-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11608751 |
| Molecular Formula | C13H25NO3Si |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-methylidene-1,3-oxazolidin-2-one |
| SMILES | C=C1CN(CCCO[Si](C)(C)C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C13H25NO3Si/c1-11-10-14(12(15)17-11)8-7-9-16-18(5,6)13(2,3)4/h1,7-10H2,2-6H3 |
| InChIKey | ZODODEKFHGBNDG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|